Type: Neutral
Formula: C22H35NO5
SMILES: |
O1C2C(CC1=O)C1(C(CC2)C(CO)(C)C(OC(=O)NC2CCCCC2)CC1)C |
InChI: |
InChI=1/C22H35NO5/c1-21-11-10-18(28-20(26)23-14-6-4-3-5-7-14)22(2,13-24)17(21)9-8-16-15(21)12-19(25)27-16/h14-18,24H,3-13H2,1-2H3,(H,23,26)/t15-,16-,17-,18-,21+,22+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 393.524 g/mol | logS: -3.67453 | SlogP: 3.5543 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.100314 | Sterimol/B1: 2.29729 | Sterimol/B2: 4.4186 | Sterimol/B3: 5.44879 |
Sterimol/B4: 5.91275 | Sterimol/L: 18.5188 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 628.125 | Positive charged surface: 462.87 | Negative charged surface: 165.256 | Volume: 383.625 |
Hydrophobic surface: 452.981 | Hydrophilic surface: 175.144 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |