Type: Neutral
Formula: C16H19N3O4S
SMILES: |
s1cccc1C(=O)NC1C2N(CC1)C(=O)C1N(CC(OC)C1)C2=O |
InChI: |
InChI=1/C16H19N3O4S/c1-23-9-7-11-15(21)18-5-4-10(13(18)16(22)19(11)8-9)17-14(20)12-3-2-6-24-12/h2-3,6,9-11,13H,4-5,7-8H2,1H3,(H,17,20)/t9-,10+,11+,13+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 349.411 g/mol | logS: -2.46354 | SlogP: 0.0769 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.069175 | Sterimol/B1: 2.38148 | Sterimol/B2: 3.32029 | Sterimol/B3: 4.26825 |
Sterimol/B4: 6.56816 | Sterimol/L: 18.2788 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 583.092 | Positive charged surface: 372.839 | Negative charged surface: 210.253 | Volume: 309.875 |
Hydrophobic surface: 467.816 | Hydrophilic surface: 115.276 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |