 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1nnn(c1)CC1N2CC(C(C1)CC2)C(=O)NC1CCCC1)c1ccccc1 |
| InChI: | InChI=1/C23H31N5O2/c29-23(24-18-6-4-5-7-18)22-15-27-11-10-17(22)12-20(27)14-28-13-19(25-26-28)16-30-21-8-2-1-3-9-21/h1-3,8-9,13,17-18,20,22H,4-7,10-12,14-16H2,(H,24,29)/t17-,20-,22+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=99.3547 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 409.534 g/mol | logS: -2.7668 | SlogP: 3.1591 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0716919 | Sterimol/B1: 3.2023 | Sterimol/B2: 3.55922 | Sterimol/B3: 4.84283 | |||
| Sterimol/B4: 8.36779 | Sterimol/L: 19.8238 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 713.868 | Positive charged surface: 493.713 | Negative charged surface: 220.155 | Volume: 404.25 | |||
| Hydrophobic surface: 619.621 | Hydrophilic surface: 94.247 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
