 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC12C(Cc3c(C1=O)c(O)c1c(cccc1O)c3C)C(N(C)C)C(O)=C(C(=O)N)C2= O |
| InChI: | InChI=1/C22H22N2O7/c1-8-9-5-4-6-12(25)13(9)17(26)14-10(8)7-11-16(24(2)3)18(27)15(21(23)30)20(29)22(11,31)19(14)28/h4-6,11,16,25-27,31H,7H2,1-3H3,(H2,23,30)/t11-,16-,22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=151.494 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 426.425 g/mol | logS: -4.22148 | SlogP: 0.45579 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.178178 | Sterimol/B1: 2.65792 | Sterimol/B2: 3.90946 | Sterimol/B3: 5.05168 | |||
| Sterimol/B4: 7.46312 | Sterimol/L: 15.4518 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 603.344 | Positive charged surface: 389.576 | Negative charged surface: 203.539 | Volume: 368.875 | |||
| Hydrophobic surface: 337.254 | Hydrophilic surface: 266.09 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 6 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
