 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(CO)C(NC(=O)C([NH3+])Cc2ccc(OC)cc2)C(O)C1n1c2ncnc(N(C)C)c 2nc1 |
| InChI: | InChI=1/C22H29N7O5/c1-28(2)19-17-20(25-10-24-19)29(11-26-17)22-18(31)16(15(9-30)34-22)27-21(32)14(23)8-12-4-6-13(33-3)7-5-12/h4-7,10-11,14-16,18,22,30-31H,8-9,23H2,1-3H3,(H,27,32)/p+1/t14-,15+,16+,18+,22+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=105.066 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 472.526 g/mol | logS: -3.09104 | SlogP: -1.41503 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0544375 | Sterimol/B1: 2.38101 | Sterimol/B2: 3.49712 | Sterimol/B3: 4.27417 | |||
| Sterimol/B4: 10.8361 | Sterimol/L: 20.3185 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 763.397 | Positive charged surface: 616.93 | Negative charged surface: 146.467 | Volume: 438.5 | |||
| Hydrophobic surface: 542.768 | Hydrophilic surface: 220.629 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
