 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Clc1c2c(c(O)c3c(CC4C(O)(C(=O)C(C(=O)N)C(=O)C4N(C)C)C3=O)c2C) c(O)cc1 |
| InChI: | InChI=1/C22H21ClN2O7/c1-7-8-6-9-16(25(2)3)18(28)15(21(24)31)20(30)22(9,32)19(29)13(8)17(27)14-11(26)5-4-10(23)12(7)14/h4-5,9,15-16,26-27,32H,6H2,1-3H3,(H2,24,31)/t9-,15+,16-,22-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=196.393 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 460.87 g/mol | logS: -4.85411 | SlogP: 0.48239 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.206618 | Sterimol/B1: 2.61232 | Sterimol/B2: 3.92945 | Sterimol/B3: 5.31882 | |||
| Sterimol/B4: 8.36832 | Sterimol/L: 13.8265 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 590.462 | Positive charged surface: 363.398 | Negative charged surface: 217.05 | Volume: 377.125 | |||
| Hydrophobic surface: 361.401 | Hydrophilic surface: 229.061 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
