Drugs present in MMsINC which are similar to the molecule MMscode: MMs03950156
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727527![]() | [NH3+]C(Cc1ccccc1)C | 0.75 |
MMs01727529![]() | [NH3+]C(Cc1ccccc1)C | 0.75 |
MMs01725803![]() | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.74 |
MMs01726626![]() | [NH2+]=C(N)c1ccc(NN=Nc2ccc(cc2)C(=[NH2+])N)cc1 | 0.73 |
MMs01725298![]() | [NH3+]C1CC1c1ccccc1 | 0.71 |
MMs01725649![]() | [NH3+]C1CC1c1ccccc1 | 0.71 |
MMs01725446![]() | [NH3+]C1CC1c1ccccc1 | 0.71 |