Drugs present in MMsINC which are similar to the molecule MMscode: MMs03926464
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727473![]() | OC1C2C3CCC(C(CCC(O)=O)C)C3(CCC2C2(C(C1)CC(O)CC2)C)C | 0.71 |
MMs01727475![]() | OC1C2C3CCC(C(CCC(O)=O)C)C3(CCC2C2(C(C1)CC(O)CC2)C)C | 0.71 |
MMs01727477![]() | OC1C2C3CCC(C(CCC(O)=O)C)C3(CCC2C2(C(C1)CC(O)CC2)C)C | 0.71 |
MMs01727479![]() | OC1C2C3CCC(C(CCC(O)=O)C)C3(CCC2C2(C(C1)CC(O)CC2)C)C | 0.71 |
MMs01725383![]() | OC1CC(CCC1C(C)C)C | 0.70 |