Drugs present in MMsINC which are similar to the molecule MMscode: MMs03919411
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725044![]() | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.86 |
MMs01725045![]() | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.86 |
MMs01725046![]() | O1C(CCC1N1C=CC(=NC1=O)N)CO | 0.86 |
MMs01726005![]() | O1C2N3C=CC(N=C3OC2C(O)C1CO)=N | 0.74 |
MMs01726007![]() | O1C2N3C=CC(N=C3OC2C(O)C1CO)=N | 0.74 |
MMs01726031![]() | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.74 |
MMs01726029![]() | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.74 |
MMs01726030![]() | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.74 |
MMs01725414![]() | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.74 |