Drugs present in MMsINC which are similar to the molecule MMscode: MMs03918852
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727763 | OC1N=C(NC(C1)C1NC(=O)/C(/NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CC(N)CCCN)CNC1=O)CO)CO)=C/NC(=O)N)N | 0.73 |
MMs01727767 | OC1N=C(NC(C1)C1NC(=O)/C(/NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CC(N)CCCN)CNC1=O)CO)CO)=C/NC(=O)N)N | 0.73 |
MMs01727771 | OC1N=C(NC(C1)C1NC(=O)/C(/NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CC(N)CCCN)CNC1=O)CO)CO)=C/NC(=O)N)N | 0.73 |
MMs01727775 | OC1N=C(NC(C1)C1NC(=O)/C(/NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CC(N)CCCN)CNC1=O)CO)CO)=C/NC(=O)N)N | 0.73 |
MMs01726810 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.70 |
MMs01726812 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.70 |
MMs01726808 | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.70 |