Drugs present in MMsINC which are similar to the molecule MMscode: MMs03918851
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727763![]() | OC1N=C(NC(C1)C1NC(=O)/C(/NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CC(N)CCCN)CNC1=O)CO)CO)=C/NC(=O)N)N | 0.72 |
MMs01727767![]() | OC1N=C(NC(C1)C1NC(=O)/C(/NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CC(N)CCCN)CNC1=O)CO)CO)=C/NC(=O)N)N | 0.72 |
MMs01727771![]() | OC1N=C(NC(C1)C1NC(=O)/C(/NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CC(N)CCCN)CNC1=O)CO)CO)=C/NC(=O)N)N | 0.72 |
MMs01727775![]() | OC1N=C(NC(C1)C1NC(=O)/C(/NC(=O)C(NC(=O)C(NC(=O)C(NC(=O)CC(N)CCCN)CNC1=O)CO)CO)=C/NC(=O)N)N | 0.72 |
MMs01726810![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.71 |
MMs01726812![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.71 |
MMs01726808![]() | SCC(NC(=O)CCC(N)C(O)=O)C(=O)NCC(O)=O | 0.71 |