Drugs present in MMsINC which are similar to the molecule MMscode: MMs03918835
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725784 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.76 |
MMs01725782 | OC(=O)CCC(NC(=O)c1ccccc1)C(=O)N(CCC)CCC | 0.76 |
MMs01725453 | O=C1N=C(NC=2NCC(N(C1=2)C=O)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.72 |
MMs01725483 | S1C2N(C(=O)C2NC(=O)C(N)c2ccccc2)C(C(O)=O)=C(C1)C | 0.72 |
MMs01725472 | ClC=1CSC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.70 |
MMs01725470 | ClC=1CSC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.70 |
MMs01726195 | ClC=1CSC2N(C(=O)C2NC(=O)C(N)c2ccccc2)C=1C(O)=O | 0.70 |