Drugs present in MMsINC which are similar to the molecule MMscode: MMs03891803
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727031 | OC1C(O)C(O)CN(CCO)C1CO | 0.86 |
MMs01727033 | OC1C(O)C(O)CN(CCO)C1CO | 0.86 |
MMs01727035 | OC1C(O)C(O)CN(CCO)C1CO | 0.86 |
MMs01727037 | OC1C(O)C(O)CN(CCO)C1CO | 0.86 |
MMs01726021 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.74 |
MMs01726023 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.74 |
MMs01726025 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.74 |
MMs01726027 | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.74 |
MMs01727637 | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CCC1CN | 0.70 |
MMs01727639 | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CCC1CN | 0.70 |
MMs01727641 | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CCC1CN | 0.70 |
MMs01727643 | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CCC1CN | 0.70 |