Drugs present in MMsINC which are similar to the molecule MMscode: MMs03877716
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.78 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.75 |
MMs01724802 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.75 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.75 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.74 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.72 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.71 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.71 |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.70 |
MMs01725459 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.70 |
MMs01725457 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.70 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.70 |