Drugs present in MMsINC which are similar to the molecule MMscode: MMs03875916
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724860 | Clc1ccccc1CC([NH3+])(C)C | 0.81 |
MMs01725157 | Clc1ccc(cc1)C1(CCC1)C([NH+](C)C)CC(C)C | 0.79 |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.78 |
MMs01725406 | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.76 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.75 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.73 |
MMs01725063 | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.72 |
MMs01724845 | Brc1ccccc1C[N+](CC)(C)C | 0.71 |
MMs01725446 | [NH3+]C1CC1c1ccccc1 | 0.70 |