Drugs present in MMsINC which are similar to the molecule MMscode: MMs03867033
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724969![]() | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.72 |
MMs01725055![]() | S1c2c(N(c3c1cccc3)CC([NH+](CC)CC)C)cccc2 | 0.72 |
MMs01725008![]() | S1c2c(N(c3c1cccc3)CCC[NH+](C)C)cccc2 | 0.71 |
MMs01725300![]() | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.70 |
MMs01724823![]() | S1c2c(N(c3c1cccc3)CC(C[NH+](C)C)C)cccc2 | 0.70 |
MMs01725521![]() | S1c2c(N(c3c1cccc3)CCC1[NH+](CCCC1)C)cc(SC)cc2 | 0.70 |
MMs01725519![]() | S1c2c(N(c3c1cccc3)CCC1[NH+](CCCC1)C)cc(SC)cc2 | 0.70 |
MMs01725180![]() | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCN(CC1)CCOC(=O)C | 0.70 |