Drugs present in MMsINC which are similar to the molecule MMscode: MMs03857290
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727440 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(C(O)=O)c1ccsc1 | 0.72 |
MMs01727434 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(C(O)=O)c1ccsc1 | 0.72 |
MMs01727436 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(C(O)=O)c1ccsc1 | 0.72 |
MMs01727438 | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)C(C(O)=O)c1ccsc1 | 0.72 |
MMs01726303 | s1cccc1CC(=O)NC1(OC)C2SCC(COC(=O)N)=C(N2C1=O)C(O)=O | 0.72 |
MMs01726305 | s1cccc1CC(=O)NC1(OC)C2SCC(COC(=O)N)=C(N2C1=O)C(O)=O | 0.72 |
MMs01726307 | s1cccc1CC(=O)NC1(OC)C2SCC(COC(=O)N)=C(N2C1=O)C(O)=O | 0.72 |
MMs01726309 | s1cccc1CC(=O)NC1(OC)C2SCC(COC(=O)N)=C(N2C1=O)C(O)=O | 0.72 |