Drugs present in MMsINC which are similar to the molecule MMscode: MMs03851364
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724772![]() | O1C(CNC1=O)COc1ccccc1OC | 0.74 |
MMs01725806![]() | O1C(CNC1=O)COc1ccccc1OC | 0.74 |
MMs01725375![]() | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.71 |
MMs01724775![]() | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.71 |
MMs01726973![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.71 |
MMs01725777![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.71 |
MMs01726971![]() | S1C2N(C(C(O)=O)C1(C)C)C(=O)C2NC(=O)c1c(OC)cccc1OC | 0.71 |
MMs01725292![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.70 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.70 |
MMs01725169![]() | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.70 |