Drugs present in MMsINC which are similar to the molecule MMscode: MMs03810990
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725977 | OC1CC(=O)C(CCCCCCC(O)=O)C1\C=C\C(O)CCCCC | 0.72 |
MMs01725979 | OC1CC(=O)C(CCCCCCC(O)=O)C1\C=C\C(O)CCCCC | 0.72 |
MMs01725981 | OC1CC(=O)C(CCCCCCC(O)=O)C1\C=C\C(O)CCCCC | 0.72 |
MMs01726636 | OC1CC(=O)C(C\C=C/CCCC(O)=O)C1\C=C\C(O)CCCCC | 0.71 |
MMs01726638 | OC1CC(=O)C(C\C=C/CCCC(O)=O)C1\C=C\C(O)CCCCC | 0.71 |
MMs01726640 | OC1CC(=O)C(C\C=C/CCCC(O)=O)C1\C=C\C(O)CCCCC | 0.71 |