Drugs present in MMsINC which are similar to the molecule MMscode: MMs03783416
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726035 | O1C(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1N1N=CC(=O)NC1=O | 0.82 |
MMs01726032 | O1C(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1N1N=CC(=O)NC1=O | 0.82 |
MMs01726033 | O1C(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1N1N=CC(=O)NC1=O | 0.82 |
MMs01726034 | O1C(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1N1N=CC(=O)NC1=O | 0.82 |
MMs01725414 | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.71 |
MMs01726029 | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.71 |
MMs01726030 | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.71 |
MMs01726031 | O1C(CO)C(O)C(O)C1N1C=NC(=NC1=O)N | 0.71 |