Drugs present in MMsINC which are similar to the molecule MMscode: MMs03781847
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724984![]() | s1c2Nc3c(N=C(N4CC[NH+](CC4)C)c2cc1C)cccc3 | 0.79 |
MMs01724862![]() | Clc1cc2c(Sc3c(N=C2N2CC[NH+](CC2)C)cccc3)cc1 | 0.76 |
MMs01725061![]() | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.73 |
MMs01724922![]() | s1c2c(cc1)C(c1c(CC2)cccc1)=C1CC[NH+](CC1)C | 0.71 |
MMs01724778![]() | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.71 |
MMs01725302![]() | S1c2c(N(c3c1cccc3)CC1CC[NH+](C1)C)cccc2 | 0.71 |