Drugs present in MMsINC which are similar to the molecule MMscode: MMs03781082
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724744![]() | O=C(C(N(CC)CC)C)c1ccccc1 | 0.85 |
MMs01725027![]() | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.80 |
MMs01725063![]() | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.80 |
MMs01725092![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.79 |
MMs01725094![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.79 |
MMs01725525![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.76 |
MMs01725524![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.76 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.75 |
MMs01724898![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(CC1)C | 0.75 |
MMs01727529![]() | [NH3+]C(Cc1ccccc1)C | 0.74 |
MMs01727527![]() | [NH3+]C(Cc1ccccc1)C | 0.74 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725446![]() | [NH3+]C1CC1c1ccccc1 | 0.73 |
MMs01725298![]() | [NH3+]C1CC1c1ccccc1 | 0.73 |
MMs01725649![]() | [NH3+]C1CC1c1ccccc1 | 0.73 |
MMs01724832![]() | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.71 |