Drugs present in MMsINC which are similar to the molecule MMscode: MMs03776548
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725448 | Oc1cc(ccc1O)CC(N)C(O)=O | 0.92 |
MMs01725108 | Oc1cc(ccc1O)CC(N)(C(O)=O)C | 0.86 |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.86 |
MMs01725376 | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.74 |
MMs01725077 | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.73 |
MMs01724814 | Oc1cc(cc(O)c1)C(O)CNC(C)(C)C | 0.72 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.71 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.70 |