Drugs present in MMsINC which are similar to the molecule MMscode: MMs03767088
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.79 |
MMs01727169![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.78 |
MMs01725130![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.78 |
MMs01727173![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.78 |
MMs01727171![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.78 |
MMs01725147![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.77 |
MMs01724804![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.77 |
MMs01724814![]() | Oc1cc(cc(O)c1)C(O)CNC(C)(C)C | 0.73 |
MMs01725387![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01725386![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.72 |
MMs01724780![]() | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725116![]() | O(C)c1ccccc1CC(NC)C | 0.72 |
MMs01725376![]() | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.71 |
MMs01725123![]() | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.71 |
MMs01725840![]() | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01724764![]() | OC(CN1CC[N+](CC1)(C)C)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725399![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725395![]() | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.70 |
MMs01725397![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725087![]() | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.70 |