Drugs present in MMsINC which are similar to the molecule MMscode: MMs03764767
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727460 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.75 |
MMs01727457 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.75 |
MMs01727458 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.75 |
MMs01727459 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.75 |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.72 |
MMs01725323 | O1CCNC(C)C1c1ccccc1 | 0.72 |
MMs01725325 | O1CCNC(C)C1c1ccccc1 | 0.72 |
MMs01725327 | O1CCNC(C)C1c1ccccc1 | 0.72 |