Drugs present in MMsINC which are similar to the molecule MMscode: MMs03737447
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726842 | OC1Cc2c(cccc2)C1NC(=O)C(Cc1ccccc1)CC(O)CN1CCN(CC1C(=O)NC(C)(C)C)Cc1cccnc1 | 0.79 |
MMs01726844 | OC1Cc2c(cccc2)C1NC(=O)C(Cc1ccccc1)CC(O)CN1CCN(CC1C(=O)NC(C)(C)C)Cc1cccnc1 | 0.79 |
MMs01725677 | O=C(NNCCC(=O)NCc1ccccc1)c1ccncc1 | 0.77 |
MMs01725821 | S1C2N(C(=O)C2NC(=O)C(S(O)(=O)=O)c2ccccc2)C(C(O)=O)=C(C1)C[n+]1ccc(cc1)C(=O)N | 0.74 |
MMs01726335 | S1C2N(C(=O)C2NC(=O)C(S(O)(=O)=O)c2ccccc2)C(C(O)=O)=C(C1)C[n+]1ccc(cc1)C(=O)N | 0.74 |
MMs01725621 | S1C2N(C(=O)C2NC(=O)C(S(O)(=O)=O)c2ccccc2)C(C(O)=O)=C(C1)C[n+]1ccc(cc1)C(=O)N | 0.74 |
MMs01726333 | S1C2N(C(=O)C2NC(=O)C(S(O)(=O)=O)c2ccccc2)C(C(O)=O)=C(C1)C[n+]1ccc(cc1)C(=O)N | 0.74 |
MMs01727009 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.73 |
MMs01725678 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.73 |
MMs01727005 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.73 |
MMs01727007 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.73 |
MMs01726969 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.72 |
MMs01725416 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.72 |
MMs01725098 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.72 |
MMs01726967 | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3[nH]c1)CC | 0.72 |
MMs01724945 | [NH+]1(CCCC1)C\C=C(/c1ccc(cc1)C)\c1ncccc1 | 0.71 |
MMs01725611 | O=C1NC(=Nc2ncc(nc12)CNc1ccc(cc1)C(=O)NC(CCC(O)=O)C(O)=O)N | 0.71 |
MMs01724786 | O1CCN(CC1)CC1CCc2[nH]c(C)c(c2C1=O)CC | 0.71 |
MMs01725314 | O1CCN(CC1)CC1CCc2[nH]c(C)c(c2C1=O)CC | 0.71 |
MMs01725150 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.70 |
MMs01724798 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.70 |