Drugs present in MMsINC which are similar to the molecule MMscode: MMs03731902
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725715![]() | O(CCCN(C)C)C1(CCCCCC1)Cc1ccccc1 | 0.74 |
MMs01725387![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.74 |
MMs01725386![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.74 |
MMs01725446![]() | [NH3+]C1CC1c1ccccc1 | 0.73 |
MMs01725397![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725399![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725087![]() | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725734![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725733![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725735![]() | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01724804![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01725147![]() | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01724873![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725745![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725747![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725749![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01726106![]() | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.70 |
MMs01726108![]() | OC(CCN1CCCCC1)(C12CC(CC1)C=C2)c1ccccc1 | 0.70 |