Drugs present in MMsINC which are similar to the molecule MMscode: MMs03727892
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724989![]() | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.78 |
MMs01724870![]() | Clc1cccc(Cl)c1OC(C)C=1NCCN=1 | 0.78 |
MMs01724951![]() | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.77 |
MMs01724731![]() | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.77 |
MMs01725169![]() | Clc1ccc(OC(C(=O)NC(=O)NCN2CCOCC2)(C)C)cc1 | 0.71 |
MMs01725338![]() | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.70 |
MMs01725721![]() | O(CC(O)CNC(C)C)c1ccc(O)cc1 | 0.70 |