Drugs present in MMsINC which are similar to the molecule MMscode: MMs03727780
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727529![]() | [NH3+]C(Cc1ccccc1)C | 0.76 |
MMs01727527![]() | [NH3+]C(Cc1ccccc1)C | 0.76 |
MMs01725664![]() | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01725023![]() | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01725662![]() | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01724903![]() | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01725668![]() | Oc1ccc(cc1)CC(N)C | 0.73 |
MMs01725298![]() | [NH3+]C1CC1c1ccccc1 | 0.71 |
MMs01725446![]() | [NH3+]C1CC1c1ccccc1 | 0.71 |
MMs01725649![]() | [NH3+]C1CC1c1ccccc1 | 0.71 |
MMs01727171![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727173![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01725130![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727169![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |