Drugs present in MMsINC which are similar to the molecule MMscode: MMs03707984
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724871![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01725309![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01725817![]() | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.75 |
MMs01725132![]() | O(C(=O)C(CO)c1ccccc1)C1CC2[N+]([O-])(C(C1)CC2)C | 0.71 |
MMs01725327![]() | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725323![]() | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725325![]() | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01724800![]() | O1CCNC(C)C1c1ccccc1 | 0.71 |
MMs01725759![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725761![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725763![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |
MMs01725757![]() | O(C)c1cc(ccc1)C(=O)CCNC(C(O)c1ccccc1)C | 0.70 |