Drugs present in MMsINC which are similar to the molecule MMscode: MMs03674777
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724729![]() | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.74 |
MMs01725739![]() | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.74 |
MMs01725384![]() | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.71 |
MMs01725517![]() | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.71 |
MMs01724775![]() | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.70 |
MMs01725530![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.70 |
MMs01725532![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.70 |