Drugs present in MMsINC which are similar to the molecule MMscode: MMs03648307
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725549 | [NH2+](CCCC1c2c(C=Cc3c1cccc3)cccc2)C | 0.73 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725660 | [NH+](CC(CC1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.73 |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01725309 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.73 |
MMs01724925 | O=C1NCNC(=O)C1(CC)c1ccccc1 | 0.72 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.72 |
MMs01724888 | O1C2(CCN(CC2)CCc2ccccc2)CNC1=O | 0.72 |
MMs01724929 | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.71 |
MMs01726926 | O=C1N(C)C(=O)NC(=O)C1(CC)c1ccccc1 | 0.71 |
MMs01727287 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725536 | [NH2+](CCC=C1c2c(CCc3c1cccc3)cccc2)C | 0.70 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.70 |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.70 |