Drugs present in MMsINC which are similar to the molecule MMscode: MMs03610580
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725517 | S(=O)(=O)(N)c1cc(ccc1OC)CC(NCCOc1ccccc1OCC)C | 0.83 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.76 |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.75 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.74 |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.74 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.74 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.74 |
MMs01725459 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.73 |
MMs01725457 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOCC1CC1 | 0.73 |
MMs01725143 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.73 |
MMs01724784 | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.73 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.73 |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.73 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.73 |
MMs01725384 | S(=O)(=O)(CC)c1cc(C(=O)NCC2N(CCC2)CC)c(OC)cc1 | 0.72 |