Drugs present in MMsINC which are similar to the molecule MMscode: MMs03578830
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.74 |
MMs01725753 | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.73 |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.73 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.73 |
MMs01725463 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.72 |
MMs01725461 | O(CC(O)CNC(C)C)c1ccc(cc1)COCCOC(C)C | 0.72 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.70 |
MMs01725130 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727169 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727171 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |
MMs01727173 | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.70 |