Drugs present in MMsINC which are similar to the molecule MMscode: MMs03532756
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725408![]() | S1C(Cc2ccc(OCCN(C)c3ncccc3)cc2)C(=O)NC1=O | 0.79 |
MMs01724747![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.71 |
MMs01725112![]() | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.71 |
MMs01725206![]() | O(C)c1c(OC)cc(NCc2ccc3nc(nc(N)c3c2C)N)cc1OC | 0.70 |
MMs01725051![]() | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.70 |
MMs01725053![]() | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.70 |








