Drugs present in MMsINC which are similar to the molecule MMscode: MMs03524508
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724880 | ClC(Cl)C(=O)N(C)c1ccc(O)cc1 | 0.74 |
MMs01724849 | ClCCN(CCCl)c1ccc(cc1)CCCC(O)=O | 0.73 |
MMs01725073 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.71 |
MMs01725075 | Clc1cc(cc(Cl)c1N)C(O)CNC(C)(C)C | 0.71 |
MMs01726777 | Clc1cc2c(N(CCO)C(=O)CN3CCOC23c2ccccc2F)cc1 | 0.70 |
MMs01725176 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.70 |