Drugs present in MMsINC which are similar to the molecule MMscode: MMs03513638
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725080 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.70 |
MMs01725081 | O(CC(O)COC(=O)N)c1ccccc1OC | 0.70 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.70 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.70 |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.70 |