Drugs present in MMsINC which are similar to the molecule MMscode: MMs03504465
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726770![]() | FC12C(C3CCC(O)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)CCC12C | 0.73 |
MMs01726767![]() | FC12C(C3CCC(O)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)CCC12C | 0.73 |
MMs01726768![]() | FC12C(C3CCC(O)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)CCC12C | 0.73 |
MMs01726769![]() | FC12C(C3CCC(O)(C(=O)CO)C3(CC1O)C)CCC1=CC(=O)CCC12C | 0.73 |
MMs01726502![]() | OC1(CCC2C3C(C4(C(=CC(=O)CC4)CC3)C)C(=O)CC12C)C(=O)CO | 0.72 |
MMs01726503![]() | OC1(CCC2C3C(C4(C(=CC(=O)CC4)CC3)C)C(=O)CC12C)C(=O)CO | 0.72 |
MMs01726504![]() | OC1(CCC2C3C(C4(C(=CC(=O)CC4)CC3)C)C(=O)CC12C)C(=O)CO | 0.72 |
MMs01726505![]() | OC1(CCC2C3C(C4(C(=CC(=O)CC4)CC3)C)C(=O)CC12C)C(=O)CO | 0.72 |