Drugs present in MMsINC which are similar to the molecule MMscode: MMs03496384
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727529 | [NH3+]C(Cc1ccccc1)C | 0.81 |
MMs01727527 | [NH3+]C(Cc1ccccc1)C | 0.81 |
MMs01725298 | [NH3+]C1CC1c1ccccc1 | 0.75 |
MMs01725649 | [NH3+]C1CC1c1ccccc1 | 0.75 |
MMs01725446 | [NH3+]C1CC1c1ccccc1 | 0.75 |
MMs01725427 | [NH+](C(Cc1ccccc1)C)(CC#C)C | 0.74 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.71 |