Drugs present in MMsINC which are similar to the molecule MMscode: MMs03494895
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725243 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.81 |
MMs01725644 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.81 |
MMs01725645 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.81 |
MMs01725176 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)CO | 0.81 |
MMs01727424 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.76 |
MMs01725811 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.76 |
MMs01725851 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.76 |
MMs01727422 | ClC(Cl)C(=O)NC(C(O)c1ccc(S(=O)(=O)C)cc1)COC(=O)CN | 0.76 |
MMs01725662 | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01725023 | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01724903 | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01725664 | Oc1cc(ccc1)C(O)C(N)C | 0.75 |
MMs01725668 | Oc1ccc(cc1)CC(N)C | 0.72 |