Drugs present in MMsINC which are similar to the molecule MMscode: MMs03458880
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727280 | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.83 |
MMs01727282 | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.83 |
MMs01727284 | O=C1NC(CC1)C(=O)NC(Cc1[nH]cnc1)C(=O)N1CCCC1C(=O)N | 0.83 |
MMs01725106 | O1CC(Cc2n(cnc2)C)C(CC)C1=O | 0.72 |
MMs01725107 | O1CC(Cc2n(cnc2)C)C(CC)C1=O | 0.72 |
MMs01725120 | [nH]1cc(nc1)CCN | 0.70 |