Drugs present in MMsINC which are similar to the molecule MMscode: MMs03445157
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726838 | S(CCNC=N)C=1CC2N(C(=O)C2C(O)C)C=1C(O)=O | 0.77 |
MMs01726840 | S(CCNC=N)C=1CC2N(C(=O)C2C(O)C)C=1C(O)=O | 0.77 |
MMs01725485 | S1C2N(C(=O)C2NC(=O)C(N)C=2CC=CCC=2)C(C(O)=O)=C(C1)C | 0.70 |
MMs01726403 | S1C2N(C(=O)C2NC(=O)C(N)C=2CC=CCC=2)C(C(O)=O)=C(C1)C | 0.70 |
MMs01726405 | S1C2N(C(=O)C2NC(=O)C(N)C=2CC=CCC=2)C(C(O)=O)=C(C1)C | 0.70 |
MMs01726407 | S1C2N(C(=O)C2NC(=O)C(N)C=2CC=CCC=2)C(C(O)=O)=C(C1)C | 0.70 |