Drugs present in MMsINC which are similar to the molecule MMscode: MMs03439774
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725049![]() | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.74 |
MMs01725395![]() | OC(CCCN1CCCCC1)(c1ccccc1)c1ccccc1 | 0.73 |
MMs01725397![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.73 |
MMs01725399![]() | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.73 |
MMs01725185![]() | Fc1ccc(cc1)C(=O)CCCN1CCC(O)(CC1)c1cc(ccc1)C(F)(F)F | 0.70 |
MMs01725386![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725387![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725749![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725745![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01725747![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |
MMs01724873![]() | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.70 |