Drugs present in MMsINC which are similar to the molecule MMscode: MMs03418807
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725154![]() | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.75 |
MMs01725077![]() | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.73 |
MMs01725859![]() | Oc1c(O)c(c2c(cc(C)c(-c3c(cc4c(c(C=O)c(O)c(O)c4C(C)C)c3O)C)c2O)c1C(C)C)C=O | 0.73 |
MMs01725409![]() | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.73 |
MMs01725874![]() | Oc1ccc(cc1CO)C(O)CNCCCCCCOCCCCc1ccccc1 | 0.71 |