Drugs present in MMsINC which are similar to the molecule MMscode: MMs03414278
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725751![]() | Clc1cc(ccc1OCC=C)CC(O)=O | 0.76 |
MMs01726691![]() | O(C(=O)c1ccccc1)c1cc2CCC3C4CCC(O)C4(CCC3c2cc1)C | 0.75 |
MMs01726688![]() | O(C(=O)c1ccccc1)c1cc2CCC3C4CCC(O)C4(CCC3c2cc1)C | 0.75 |
MMs01726689![]() | O(C(=O)c1ccccc1)c1cc2CCC3C4CCC(O)C4(CCC3c2cc1)C | 0.75 |
MMs01726690![]() | O(C(=O)c1ccccc1)c1cc2CCC3C4CCC(O)C4(CCC3c2cc1)C | 0.75 |
MMs01724757![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.72 |
MMs01725135![]() | O(c1cc(ccc1)C(C(O)=O)C)c1ccccc1 | 0.72 |
MMs01725340![]() | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.71 |
MMs01724776![]() | O(C)c1cc2c(cc(cc2)C(C(C(O)=O)(C)C)CC)cc1 | 0.71 |