Drugs present in MMsINC which are similar to the molecule MMscode: MMs03404868
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726794 | O1C(O)(CO)C(O)C(O)C1CO | 0.82 |
MMs01726796 | O1C(O)(CO)C(O)C(O)C1CO | 0.82 |
MMs01726798 | O1C(O)(CO)C(O)C(O)C1CO | 0.82 |
MMs01726800 | O1C(O)(CO)C(O)C(O)C1CO | 0.82 |
MMs01727445 | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.70 |
MMs01727446 | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.70 |
MMs01727447 | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.70 |
MMs01727448 | S(OCC12OC(OC1C1OC(OC1CO2)(C)C)(C)C)(=O)(=O)N | 0.70 |