Drugs present in MMsINC which are similar to the molecule MMscode: MMs03399825
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726634![]() | OC1CC(O)C(\C=C\C(O)CCCCC)C1C\C=C/CCCC(O)=O | 0.72 |
MMs01726628![]() | OC1CC(O)C(\C=C\C(O)CCCCC)C1C\C=C/CCCC(O)=O | 0.72 |
MMs01726630![]() | OC1CC(O)C(\C=C\C(O)CCCCC)C1C\C=C/CCCC(O)=O | 0.72 |
MMs01726632![]() | OC1CC(O)C(\C=C\C(O)CCCCC)C1C\C=C/CCCC(O)=O | 0.72 |
MMs01726174![]() | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.70 |
MMs01726178![]() | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.70 |
MMs01726180![]() | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.70 |
MMs01726184![]() | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.70 |