Drugs present in MMsINC which are similar to the molecule MMscode: MMs03399825
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726634 | OC1CC(O)C(\C=C\C(O)CCCCC)C1C\C=C/CCCC(O)=O | 0.72 |
MMs01726628 | OC1CC(O)C(\C=C\C(O)CCCCC)C1C\C=C/CCCC(O)=O | 0.72 |
MMs01726630 | OC1CC(O)C(\C=C\C(O)CCCCC)C1C\C=C/CCCC(O)=O | 0.72 |
MMs01726632 | OC1CC(O)C(\C=C\C(O)CCCCC)C1C\C=C/CCCC(O)=O | 0.72 |
MMs01726174 | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.70 |
MMs01726178 | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.70 |
MMs01726180 | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.70 |
MMs01726184 | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.70 |