Drugs present in MMsINC which are similar to the molecule MMscode: MMs03372338
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724788![]() | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.80 |
MMs01727468![]() | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.78 |
MMs01725425![]() | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.78 |
MMs01724782![]() | [NH+]1(CC2N(CC1)c1c(Cc3c2cccc3)cccc1)C | 0.76 |
MMs01725438![]() | [NH+](CCCN1c2c(cccc2)C(c2c1cccc2)(C)C)(C)C | 0.76 |
MMs01725446![]() | [NH3+]C1CC1c1ccccc1 | 0.76 |
MMs01725406![]() | [NH+]1(CCCCC1)C1(CCCCC1)c1ccccc1 | 0.74 |
MMs01725061![]() | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.71 |