Drugs present in MMsINC which are similar to the molecule MMscode: MMs03371583
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727733![]() | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CC=C1CN | 0.75 |
MMs01727727![]() | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CC=C1CN | 0.75 |
MMs01727729![]() | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CC=C1CN | 0.75 |
MMs01727731![]() | O1C(OC2C(O)C(OC3OCC(O)(C)C(NC)C3O)C(N)CC2N)C(N)CC=C1CN | 0.75 |
MMs01726021![]() | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.70 |
MMs01726023![]() | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.70 |
MMs01726025![]() | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.70 |
MMs01726027![]() | O1C(OC2C(N)C(O)C(OC)C(NC)C2O)C(N)CCC1C(N)C | 0.70 |