Drugs present in MMsINC which are similar to the molecule MMscode: MMs03334477
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724964 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.80 |
MMs01725125 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.80 |
MMs01725127 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.80 |
MMs01727537 | O1C(CO)C(O)CC1n1c2N=CNCC(O)c2nc1 | 0.79 |
MMs01727206 | O1C(CO)C(O)CC1n1c2N=CNCC(O)c2nc1 | 0.79 |
MMs01727207 | O1C(CO)C(O)CC1n1c2N=CNCC(O)c2nc1 | 0.79 |
MMs01725956 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |
MMs01725809 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |
MMs01725833 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |
MMs01725954 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |